C21H22O3 — CID 72530435
6-methyl-6-(3-phenylmethoxyphenyl)hepta-2,4-dienoic acid (PubChem CID 72530435) has the molecular formula C21H22O3 and a molecular weight of 322.40 g/mol. Its IUPAC name is 6-methyl-6-(3-phenylmethoxyphenyl)hepta-2,4-dienoic acid.
| Compound Name | 6-methyl-6-(3-phenylmethoxyphenyl)hepta-2,4-dienoic acid |
|---|---|
| PubChem CID | 72530435 |
| Molecular Formula | C21H22O3 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 6-methyl-6-(3-phenylmethoxyphenyl)hepta-2,4-dienoic acid |
| SMILES | CC(C)(C=CC=CC(=O)O)c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C21H22O3/c1-21(2,14-7-6-13-20(22)23)18-11-8-12-19(15-18)24-16-17-9-4-3-5-10-17/h3-15H,16H2,1-2H3,(H,22,23) |
| InChIKey | VPXKMSKKFHTHKQ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|