C24H32N4O2S — CID 72531406
2-[1-(but-2-enylcarbamoyl)piperidin-4-yl]-N-(2-tert-butylphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 72531406) has the molecular formula C24H32N4O2S and a molecular weight of 440.61 g/mol. Its IUPAC name is 2-[1-(but-2-enylcarbamoyl)piperidin-4-yl]-N-(2-tert-butylphenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[1-(but-2-enylcarbamoyl)piperidin-4-yl]-N-(2-tert-butylphenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 72531406 |
| Molecular Formula | C24H32N4O2S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 2-[1-(but-2-enylcarbamoyl)piperidin-4-yl]-N-(2-tert-butylphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | CC=CCNC(=O)N1CCC(c2nc(C(=O)Nc3ccccc3C(C)(C)C)cs2)CC1 |
| InChI | InChI=1S/C24H32N4O2S/c1-5-6-13-25-23(30)28-14-11-17(12-15-28)22-27-20(16-31-22)21(29)26-19-10-8-7-9-18(19)24(2,3)4/h5-10,16-17H,11-15H2,1-4H3,(H,25,30)(H,26,29) |
| InChIKey | RCWSSSHWFWETKE-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|