About 3-[N'-(2-fluorobenzoyl)oxycarbamimidoyl]benzoic acid
3-[N'-(2-fluorobenzoyl)oxycarbamimidoyl]benzoic acid (PubChem CID 72532902) has the molecular formula C15H11FN2O4
and a molecular weight of 302.26 g/mol. Its IUPAC name is 3-[N'-(2-fluorobenzoyl)oxycarbamimidoyl]benzoic acid.
Molecular Properties
| Compound Name | 3-[N'-(2-fluorobenzoyl)oxycarbamimidoyl]benzoic acid |
| PubChem CID | 72532902 |
| Molecular Formula | C15H11FN2O4 |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 3-[N'-(2-fluorobenzoyl)oxycarbamimidoyl]benzoic acid |
| SMILES | NC(=NOC(=O)c1ccccc1F)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C15H11FN2O4/c16-12-7-2-1-6-11(12)15(21)22-18-13(17)9-4-3-5-10(8-9)14(19)20/h1-8H,(H2,17,18)(H,19,20) |
| InChIKey | VSKBIBFGOCAOME-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[N'-(2-fluorobenzoyl)oxycarbamimidoyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[N'-(2-fluorobenzoyl)oxycarbamimidoyl]benzoic acid?
The IUPAC name of 3-[N'-(2-fluorobenzoyl)oxycarbamimidoyl]benzoic acid (CID 72532902) is 3-[N'-(2-fluorobenzoyl)oxycarbamimidoyl]benzoic acid.
What is the SMILES notation for 3-[N'-(2-fluorobenzoyl)oxycarbamimidoyl]benzoic acid?
The canonical SMILES for 3-[N'-(2-fluorobenzoyl)oxycarbamimidoyl]benzoic acid is NC(=NOC(=O)c1ccccc1F)c1cccc(C(=O)O)c1.
What is the InChIKey of 3-[N'-(2-fluorobenzoyl)oxycarbamimidoyl]benzoic acid?
The InChIKey is VSKBIBFGOCAOME-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11FN2O4/c16-12-7-2-1-6-11(12)15(21)22-18-13(17)9-4-3-5-10(8-9)14(19)20/h1-8H,(H2,17,18)(H,19,20).
What are the key properties of 3-[N'-(2-fluorobenzoyl)oxycarbamimidoyl]benzoic acid?
3-[N'-(2-fluorobenzoyl)oxycarbamimidoyl]benzoic acid has a molecular weight of 302.26 g/mol, XLogP of 2.00, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[N'-(2-fluorobenzoyl)oxycarbamimidoyl]benzoic acid is sourced from PubChem (CID 72532902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).