About thietan-3-yl thiophene-2-carboxylate
thietan-3-yl thiophene-2-carboxylate (PubChem CID 725336) has the molecular formula C8H8O2S2
and a molecular weight of 200.28 g/mol. Its IUPAC name is thietan-3-yl thiophene-2-carboxylate.
Molecular Properties
| Compound Name | thietan-3-yl thiophene-2-carboxylate |
| PubChem CID | 725336 |
| Molecular Formula | C8H8O2S2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.00 |
| IUPAC Name | thietan-3-yl thiophene-2-carboxylate |
| SMILES | O=C(OC1CSC1)c1cccs1 |
| InChI | InChI=1S/C8H8O2S2/c9-8(7-2-1-3-12-7)10-6-4-11-5-6/h1-3,6H,4-5H2 |
| InChIKey | WLQDLXIEVOGMDM-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze thietan-3-yl thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thietan-3-yl thiophene-2-carboxylate?
The IUPAC name of thietan-3-yl thiophene-2-carboxylate (CID 725336) is thietan-3-yl thiophene-2-carboxylate.
What is the SMILES notation for thietan-3-yl thiophene-2-carboxylate?
The canonical SMILES for thietan-3-yl thiophene-2-carboxylate is O=C(OC1CSC1)c1cccs1.
What is the InChIKey of thietan-3-yl thiophene-2-carboxylate?
The InChIKey is WLQDLXIEVOGMDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2S2/c9-8(7-2-1-3-12-7)10-6-4-11-5-6/h1-3,6H,4-5H2.
What are the key properties of thietan-3-yl thiophene-2-carboxylate?
thietan-3-yl thiophene-2-carboxylate has a molecular weight of 200.28 g/mol, XLogP of 2.02, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for thietan-3-yl thiophene-2-carboxylate is sourced from PubChem (CID 725336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).