C26H42O2S — CID 72538103
ethyl 2-ethylsulfanyldocosa-7,10,13,16,19-pentaenoate (PubChem CID 72538103) has the molecular formula C26H42O2S and a molecular weight of 418.69 g/mol. Its IUPAC name is ethyl 2-ethylsulfanyldocosa-7,10,13,16,19-pentaenoate.
| Compound Name | ethyl 2-ethylsulfanyldocosa-7,10,13,16,19-pentaenoate |
|---|---|
| PubChem CID | 72538103 |
| Molecular Formula | C26H42O2S |
| Molecular Weight | 418.69 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | ethyl 2-ethylsulfanyldocosa-7,10,13,16,19-pentaenoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCCC(SCC)C(=O)OCC |
| InChI | InChI=1S/C26H42O2S/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25(29-6-3)26(27)28-5-2/h7-8,10-11,13-14,16-17,19-20,25H,4-6,9,12,15,18,21-24H2,1-3H3 |
| InChIKey | OLFKETZOXLNKDK-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.69 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|