C12H11N3OS — CID 725400
6-(2-amino-1,3-thiazol-4-yl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 725400) has the molecular formula C12H11N3OS and a molecular weight of 245.31 g/mol. Its IUPAC name is 6-(2-amino-1,3-thiazol-4-yl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-(2-amino-1,3-thiazol-4-yl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 725400 |
| Molecular Formula | C12H11N3OS |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 6-(2-amino-1,3-thiazol-4-yl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | Nc1nc(-c2ccc3c(c2)CCC(=O)N3)cs1 |
| InChI | InChI=1S/C12H11N3OS/c13-12-15-10(6-17-12)8-1-3-9-7(5-8)2-4-11(16)14-9/h1,3,5-6H,2,4H2,(H2,13,15)(H,14,16) |
| InChIKey | FXDMXJQMOVVRFM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |