C27H29F3N2O3 — CID 72541163
2-[2,2-diethyl-7-(trifluoromethyl)-3H-chromen-4-ylidene]-N-(1-ethyl-2-oxo-3,4-dihydroquinolin-5-yl)acetamide (PubChem CID 72541163) has the molecular formula C27H29F3N2O3 and a molecular weight of 486.53 g/mol. Its IUPAC name is 2-[2,2-diethyl-7-(trifluoromethyl)-3H-chromen-4-ylidene]-N-(1-ethyl-2-oxo-3,4-dihydroquinolin-5-yl)acetamide.
| Compound Name | 2-[2,2-diethyl-7-(trifluoromethyl)-3H-chromen-4-ylidene]-N-(1-ethyl-2-oxo-3,4-dihydroquinolin-5-yl)acetamide |
|---|---|
| PubChem CID | 72541163 |
| Molecular Formula | C27H29F3N2O3 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | 2-[2,2-diethyl-7-(trifluoromethyl)-3H-chromen-4-ylidene]-N-(1-ethyl-2-oxo-3,4-dihydroquinolin-5-yl)acetamide |
| SMILES | CCN1C(=O)CCc2c(NC(=O)C=C3CC(CC)(CC)Oc4cc(C(F)(F)F)ccc43)cccc21 |
| InChI | InChI=1S/C27H29F3N2O3/c1-4-26(5-2)16-17(19-11-10-18(27(28,29)30)15-23(19)35-26)14-24(33)31-21-8-7-9-22-20(21)12-13-25(34)32(22)6-3/h7-11,14-15H,4-6,12-13,16H2,1-3H3,(H,31,33) |
| InChIKey | ZGPPNPGZKQVECY-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|