C26H28F3N3O4 — CID 72541291
2-[2,2-dimethyl-7-(trifluoromethyl)-3H-chromen-4-ylidene]-N-[3-(4-hydroxybutyl)-2-oxo-1,4-dihydroquinazolin-7-yl]acetamide (PubChem CID 72541291) has the molecular formula C26H28F3N3O4 and a molecular weight of 503.52 g/mol. Its IUPAC name is 2-[2,2-dimethyl-7-(trifluoromethyl)-3H-chromen-4-ylidene]-N-[3-(4-hydroxybutyl)-2-oxo-1,4-dihydroquinazolin-7-yl]acetamide.
| Compound Name | 2-[2,2-dimethyl-7-(trifluoromethyl)-3H-chromen-4-ylidene]-N-[3-(4-hydroxybutyl)-2-oxo-1,4-dihydroquinazolin-7-yl]acetamide |
|---|---|
| PubChem CID | 72541291 |
| Molecular Formula | C26H28F3N3O4 |
| Molecular Weight | 503.52 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | 2-[2,2-dimethyl-7-(trifluoromethyl)-3H-chromen-4-ylidene]-N-[3-(4-hydroxybutyl)-2-oxo-1,4-dihydroquinazolin-7-yl]acetamide |
| SMILES | CC1(C)CC(=CC(=O)Nc2ccc3c(c2)NC(=O)N(CCCCO)C3)c2ccc(C(F)(F)F)cc2O1 |
| InChI | InChI=1S/C26H28F3N3O4/c1-25(2)14-17(20-8-6-18(26(27,28)29)12-22(20)36-25)11-23(34)30-19-7-5-16-15-32(9-3-4-10-33)24(35)31-21(16)13-19/h5-8,11-13,33H,3-4,9-10,14-15H2,1-2H3,(H,30,34)(H,31,35) |
| InChIKey | XAZGCDFYWYOIOW-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.52 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|