About 1-(3,5-ditert-butyl-2-ethoxyphenyl)-2-phenylethene-1,2-dithiol
1-(3,5-ditert-butyl-2-ethoxyphenyl)-2-phenylethene-1,2-dithiol (PubChem CID 72543027) has the molecular formula C24H32OS2
and a molecular weight of 400.65 g/mol. Its IUPAC name is 1-(3,5-ditert-butyl-2-ethoxyphenyl)-2-phenylethene-1,2-dithiol.
Molecular Properties
| Compound Name | 1-(3,5-ditert-butyl-2-ethoxyphenyl)-2-phenylethene-1,2-dithiol |
| PubChem CID | 72543027 |
| Molecular Formula | C24H32OS2 |
| Molecular Weight | 400.65 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 1-(3,5-ditert-butyl-2-ethoxyphenyl)-2-phenylethene-1,2-dithiol |
| SMILES | CCOc1c(C(S)=C(S)c2ccccc2)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C24H32OS2/c1-8-25-20-18(22(27)21(26)16-12-10-9-11-13-16)14-17(23(2,3)4)15-19(20)24(5,6)7/h9-15,26-27H,8H2,1-7H3 |
| InChIKey | WTHOZXIYCRRODX-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.65 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,5-ditert-butyl-2-ethoxyphenyl)-2-phenylethene-1,2-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-ditert-butyl-2-ethoxyphenyl)-2-phenylethene-1,2-dithiol?
The IUPAC name of 1-(3,5-ditert-butyl-2-ethoxyphenyl)-2-phenylethene-1,2-dithiol (CID 72543027) is 1-(3,5-ditert-butyl-2-ethoxyphenyl)-2-phenylethene-1,2-dithiol.
What is the SMILES notation for 1-(3,5-ditert-butyl-2-ethoxyphenyl)-2-phenylethene-1,2-dithiol?
The canonical SMILES for 1-(3,5-ditert-butyl-2-ethoxyphenyl)-2-phenylethene-1,2-dithiol is CCOc1c(C(S)=C(S)c2ccccc2)cc(C(C)(C)C)cc1C(C)(C)C.
What is the InChIKey of 1-(3,5-ditert-butyl-2-ethoxyphenyl)-2-phenylethene-1,2-dithiol?
The InChIKey is WTHOZXIYCRRODX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H32OS2/c1-8-25-20-18(22(27)21(26)16-12-10-9-11-13-16)14-17(23(2,3)4)15-19(20)24(5,6)7/h9-15,26-27H,8H2,1-7H3.
What are the key properties of 1-(3,5-ditert-butyl-2-ethoxyphenyl)-2-phenylethene-1,2-dithiol?
1-(3,5-ditert-butyl-2-ethoxyphenyl)-2-phenylethene-1,2-dithiol has a molecular weight of 400.65 g/mol, XLogP of 7.37, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-ditert-butyl-2-ethoxyphenyl)-2-phenylethene-1,2-dithiol is sourced from PubChem (CID 72543027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).