C20H16N2O4S — CID 72543967
6-[(1,3-benzothiazol-2-ylamino)methyl]-5,8-dimethoxynaphthalene-1,4-dione (PubChem CID 72543967) has the molecular formula C20H16N2O4S and a molecular weight of 380.43 g/mol. Its IUPAC name is 6-[(1,3-benzothiazol-2-ylamino)methyl]-5,8-dimethoxynaphthalene-1,4-dione.
| Compound Name | 6-[(1,3-benzothiazol-2-ylamino)methyl]-5,8-dimethoxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 72543967 |
| Molecular Formula | C20H16N2O4S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 6-[(1,3-benzothiazol-2-ylamino)methyl]-5,8-dimethoxynaphthalene-1,4-dione |
| SMILES | COc1cc(CNc2nc3ccccc3s2)c(OC)c2c1C(=O)C=CC2=O |
| InChI | InChI=1S/C20H16N2O4S/c1-25-15-9-11(10-21-20-22-12-5-3-4-6-16(12)27-20)19(26-2)18-14(24)8-7-13(23)17(15)18/h3-9H,10H2,1-2H3,(H,21,22) |
| InChIKey | LJIYMWBQJIXXAX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|