About N-[[4-(5-cyano-3-pyridinyl)phenyl]methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide
N-[[4-(5-cyano-3-pyridinyl)phenyl]methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide (PubChem CID 72544375) has the molecular formula C18H16N4O3S
and a molecular weight of 368.42 g/mol. Its IUPAC name is N-[[4-(5-cyano-3-pyridinyl)phenyl]methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-[[4-(5-cyano-3-pyridinyl)phenyl]methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| PubChem CID | 72544375 |
| Molecular Formula | C18H16N4O3S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | N-[[4-(5-cyano-3-pyridinyl)phenyl]methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)NCc1ccc(-c2cncc(C#N)c2)cc1 |
| InChI | InChI=1S/C18H16N4O3S/c1-12-18(13(2)25-22-12)26(23,24)21-10-14-3-5-16(6-4-14)17-7-15(8-19)9-20-11-17/h3-7,9,11,21H,10H2,1-2H3 |
| InChIKey | HDRANTGHBHOYTB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 108.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[[4-(5-cyano-3-pyridinyl)phenyl]methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-(5-cyano-3-pyridinyl)phenyl]methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide?
The IUPAC name of N-[[4-(5-cyano-3-pyridinyl)phenyl]methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide (CID 72544375) is N-[[4-(5-cyano-3-pyridinyl)phenyl]methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
What is the SMILES notation for N-[[4-(5-cyano-3-pyridinyl)phenyl]methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide?
The canonical SMILES for N-[[4-(5-cyano-3-pyridinyl)phenyl]methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide is Cc1noc(C)c1S(=O)(=O)NCc1ccc(-c2cncc(C#N)c2)cc1.
What is the InChIKey of N-[[4-(5-cyano-3-pyridinyl)phenyl]methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide?
The InChIKey is HDRANTGHBHOYTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N4O3S/c1-12-18(13(2)25-22-12)26(23,24)21-10-14-3-5-16(6-4-14)17-7-15(8-19)9-20-11-17/h3-7,9,11,21H,10H2,1-2H3.
What are the key properties of N-[[4-(5-cyano-3-pyridinyl)phenyl]methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide?
N-[[4-(5-cyano-3-pyridinyl)phenyl]methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide has a molecular weight of 368.42 g/mol, XLogP of 2.70, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-(5-cyano-3-pyridinyl)phenyl]methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide is sourced from PubChem (CID 72544375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).