C24H25N5O2 — CID 72544743
7-[4-(2-phenyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl)butoxy]-1H-1,8-naphthyridin-2-one (PubChem CID 72544743) has the molecular formula C24H25N5O2 and a molecular weight of 415.50 g/mol. Its IUPAC name is 7-[4-(2-phenyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl)butoxy]-1H-1,8-naphthyridin-2-one.
| Compound Name | 7-[4-(2-phenyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl)butoxy]-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 72544743 |
| Molecular Formula | C24H25N5O2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 7-[4-(2-phenyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl)butoxy]-1H-1,8-naphthyridin-2-one |
| SMILES | O=c1ccc2ccc(OCCCCN3CCc4nn(-c5ccccc5)cc4C3)nc2[nH]1 |
| InChI | InChI=1S/C24H25N5O2/c30-22-10-8-18-9-11-23(26-24(18)25-22)31-15-5-4-13-28-14-12-21-19(16-28)17-29(27-21)20-6-2-1-3-7-20/h1-3,6-11,17H,4-5,12-16H2,(H,25,26,30) |
| InChIKey | RVABPFMKMREYQI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|