C20H28FN5O5 — CID 72545009
(2R,3S,4S,5R,6R)-5-fluoro-2-(hydroxymethyl)-6-[4-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]triazol-1-yl]oxane-3,4-diol (PubChem CID 72545009) has the molecular formula C20H28FN5O5 and a molecular weight of 437.47 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-5-fluoro-2-(hydroxymethyl)-6-[4-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]triazol-1-yl]oxane-3,4-diol.
| Compound Name | (2R,3S,4S,5R,6R)-5-fluoro-2-(hydroxymethyl)-6-[4-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]triazol-1-yl]oxane-3,4-diol |
|---|---|
| PubChem CID | 72545009 |
| Molecular Formula | C20H28FN5O5 |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | (2R,3S,4S,5R,6R)-5-fluoro-2-(hydroxymethyl)-6-[4-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]triazol-1-yl]oxane-3,4-diol |
| SMILES | COc1ccccc1N1CCN(Cc2cn([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3F)nn2)CC1 |
| InChI | InChI=1S/C20H28FN5O5/c1-30-15-5-3-2-4-14(15)25-8-6-24(7-9-25)10-13-11-26(23-22-13)20-17(21)19(29)18(28)16(12-27)31-20/h2-5,11,16-20,27-29H,6-10,12H2,1H3/t16-,17-,18-,19-,20-/m1/s1 |
| InChIKey | SSVIIFPCYYWMIA-LASHMREHSA-N |
| XLogP | -0.44 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |