C15H13N3O4 — CID 72545028
5-hydroxy-2-[[4-(phenoxymethyl)triazol-1-yl]methyl]pyran-4-one (PubChem CID 72545028) has the molecular formula C15H13N3O4 and a molecular weight of 299.29 g/mol. Its IUPAC name is 5-hydroxy-2-[[4-(phenoxymethyl)triazol-1-yl]methyl]pyran-4-one.
| Compound Name | 5-hydroxy-2-[[4-(phenoxymethyl)triazol-1-yl]methyl]pyran-4-one |
|---|---|
| PubChem CID | 72545028 |
| Molecular Formula | C15H13N3O4 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 5-hydroxy-2-[[4-(phenoxymethyl)triazol-1-yl]methyl]pyran-4-one |
| SMILES | O=c1cc(Cn2cc(COc3ccccc3)nn2)occ1O |
| InChI | InChI=1S/C15H13N3O4/c19-14-6-13(22-10-15(14)20)8-18-7-11(16-17-18)9-21-12-4-2-1-3-5-12/h1-7,10,20H,8-9H2 |
| InChIKey | IIXOEPKHGRTHAH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |