C22H20N2O3 — CID 72545406
5-[(2-hydroxyphenyl)iminomethyl]-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one (PubChem CID 72545406) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is 5-[(2-hydroxyphenyl)iminomethyl]-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one.
| Compound Name | 5-[(2-hydroxyphenyl)iminomethyl]-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one |
|---|---|
| PubChem CID | 72545406 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 5-[(2-hydroxyphenyl)iminomethyl]-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one |
| SMILES | O=c1oc2c3c4c(cc2cc1/C=N/c1ccccc1O)CCCN4CCC3 |
| InChI | InChI=1S/C22H20N2O3/c25-19-8-2-1-7-18(19)23-13-16-12-15-11-14-5-3-9-24-10-4-6-17(20(14)24)21(15)27-22(16)26/h1-2,7-8,11-13,25H,3-6,9-10H2/b23-13+ |
| InChIKey | CULVBLCLBVVDSZ-YDZHTSKRSA-N |
| XLogP | 3.95 |
| TPSA | 66.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|