C30H24ClN5S — CID 72545577
N-[[3-[(2-amino-4-chlorophenyl)methyl]imidazol-4-yl]methyl]-4-(1,3-benzothiazol-2-yl)-3-phenylaniline (PubChem CID 72545577) has the molecular formula C30H24ClN5S and a molecular weight of 522.08 g/mol. Its IUPAC name is N-[[3-[(2-amino-4-chlorophenyl)methyl]imidazol-4-yl]methyl]-4-(1,3-benzothiazol-2-yl)-3-phenylaniline.
| Compound Name | N-[[3-[(2-amino-4-chlorophenyl)methyl]imidazol-4-yl]methyl]-4-(1,3-benzothiazol-2-yl)-3-phenylaniline |
|---|---|
| PubChem CID | 72545577 |
| Molecular Formula | C30H24ClN5S |
| Molecular Weight | 522.08 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | N-[[3-[(2-amino-4-chlorophenyl)methyl]imidazol-4-yl]methyl]-4-(1,3-benzothiazol-2-yl)-3-phenylaniline |
| SMILES | Nc1cc(Cl)ccc1Cn1cncc1CNc1ccc(-c2nc3ccccc3s2)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C30H24ClN5S/c31-22-11-10-21(27(32)14-22)18-36-19-33-16-24(36)17-34-23-12-13-25(26(15-23)20-6-2-1-3-7-20)30-35-28-8-4-5-9-29(28)37-30/h1-16,19,34H,17-18,32H2 |
| InChIKey | WABYAVBTYJCHCG-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.08 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|