C25H30FN5O2S — CID 72545610
2-[(2-cyclohexylacetyl)-[(4-fluorophenyl)methyl]amino]-N-(3-imidazol-1-ylpropyl)-1,3-thiazole-5-carboxamide (PubChem CID 72545610) has the molecular formula C25H30FN5O2S and a molecular weight of 483.61 g/mol. Its IUPAC name is 2-[(2-cyclohexylacetyl)-[(4-fluorophenyl)methyl]amino]-N-(3-imidazol-1-ylpropyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[(2-cyclohexylacetyl)-[(4-fluorophenyl)methyl]amino]-N-(3-imidazol-1-ylpropyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 72545610 |
| Molecular Formula | C25H30FN5O2S |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | 2-[(2-cyclohexylacetyl)-[(4-fluorophenyl)methyl]amino]-N-(3-imidazol-1-ylpropyl)-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NCCCn1ccnc1)c1cnc(N(Cc2ccc(F)cc2)C(=O)CC2CCCCC2)s1 |
| InChI | InChI=1S/C25H30FN5O2S/c26-21-9-7-20(8-10-21)17-31(23(32)15-19-5-2-1-3-6-19)25-29-16-22(34-25)24(33)28-11-4-13-30-14-12-27-18-30/h7-10,12,14,16,18-19H,1-6,11,13,15,17H2,(H,28,33) |
| InChIKey | CEKJULDMQJLSMA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|