C19H32Cl2N2O5S — CID 72545642
(2S)-5-butyl-N-[(1S)-2,2-dichloro-1-[(2R,3R,4S,5S,6S)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]ethyl]-2,3,6,7-tetrahydro-1H-azepine-2-carboxamide (PubChem CID 72545642) has the molecular formula C19H32Cl2N2O5S and a molecular weight of 471.45 g/mol. Its IUPAC name is (2S)-5-butyl-N-[(1S)-2,2-dichloro-1-[(2R,3R,4S,5S,6S)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]ethyl]-2,3,6,7-tetrahydro-1H-azepine-2-carboxamide.
| Compound Name | (2S)-5-butyl-N-[(1S)-2,2-dichloro-1-[(2R,3R,4S,5S,6S)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]ethyl]-2,3,6,7-tetrahydro-1H-azepine-2-carboxamide |
|---|---|
| PubChem CID | 72545642 |
| Molecular Formula | C19H32Cl2N2O5S |
| Molecular Weight | 471.45 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | (2S)-5-butyl-N-[(1S)-2,2-dichloro-1-[(2R,3R,4S,5S,6S)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]ethyl]-2,3,6,7-tetrahydro-1H-azepine-2-carboxamide |
| SMILES | CCCCC1=CC[C@@H](C(=O)N[C@H](C(Cl)Cl)[C@H]2O[C@@H](SC)[C@@H](O)[C@@H](O)[C@H]2O)NCC1 |
| InChI | InChI=1S/C19H32Cl2N2O5S/c1-3-4-5-10-6-7-11(22-9-8-10)18(27)23-12(17(20)21)16-14(25)13(24)15(26)19(28-16)29-2/h6,11-17,19,22,24-26H,3-5,7-9H2,1-2H3,(H,23,27)/t11-,12-,13-,14+,15-,16+,19-/m0/s1 |
| InChIKey | RHUFQPZWTSCXGR-PTFVMZFFSA-N |
| XLogP | 1.31 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.45 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|