C27H37FO3Si — CID 72545738
(3Z,3aS,9R,9aS,9bS)-3-[(4-fluorophenyl)methylidene]-6,9-dimethyl-9-triethylsilyloxy-4,5,7,8,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-2-one (PubChem CID 72545738) has the molecular formula C27H37FO3Si and a molecular weight of 456.67 g/mol. Its IUPAC name is (3Z,3aS,9R,9aS,9bS)-3-[(4-fluorophenyl)methylidene]-6,9-dimethyl-9-triethylsilyloxy-4,5,7,8,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-2-one.
| Compound Name | (3Z,3aS,9R,9aS,9bS)-3-[(4-fluorophenyl)methylidene]-6,9-dimethyl-9-triethylsilyloxy-4,5,7,8,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-2-one |
|---|---|
| PubChem CID | 72545738 |
| Molecular Formula | C27H37FO3Si |
| Molecular Weight | 456.67 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | (3Z,3aS,9R,9aS,9bS)-3-[(4-fluorophenyl)methylidene]-6,9-dimethyl-9-triethylsilyloxy-4,5,7,8,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-2-one |
| SMILES | CC[Si](CC)(CC)O[C@]1(C)CCC2=C(C)CC[C@H]3/C(=C/c4ccc(F)cc4)C(=O)O[C@@H]3[C@H]21 |
| InChI | InChI=1S/C27H37FO3Si/c1-6-32(7-2,8-3)31-27(5)16-15-21-18(4)9-14-22-23(26(29)30-25(22)24(21)27)17-19-10-12-20(28)13-11-19/h10-13,17,22,24-25H,6-9,14-16H2,1-5H3/b23-17-/t22-,24-,25-,27+/m0/s1 |
| InChIKey | RXPQTMRTZAHSPB-PANFYNLRSA-N |
| XLogP | 7.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.67 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|