C21H23FO3 — CID 72545979
(3E,3aS,9R,9aS,9bS)-3-[(4-fluorophenyl)methylidene]-9-hydroxy-6,9-dimethyl-4,5,7,8,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-2-one (PubChem CID 72545979) has the molecular formula C21H23FO3 and a molecular weight of 342.41 g/mol. Its IUPAC name is (3E,3aS,9R,9aS,9bS)-3-[(4-fluorophenyl)methylidene]-9-hydroxy-6,9-dimethyl-4,5,7,8,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-2-one.
| Compound Name | (3E,3aS,9R,9aS,9bS)-3-[(4-fluorophenyl)methylidene]-9-hydroxy-6,9-dimethyl-4,5,7,8,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-2-one |
|---|---|
| PubChem CID | 72545979 |
| Molecular Formula | C21H23FO3 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | (3E,3aS,9R,9aS,9bS)-3-[(4-fluorophenyl)methylidene]-9-hydroxy-6,9-dimethyl-4,5,7,8,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-2-one |
| SMILES | CC1=C2CC[C@@](C)(O)[C@@H]2[C@H]2OC(=O)/C(=C/c3ccc(F)cc3)[C@@H]2CC1 |
| InChI | InChI=1S/C21H23FO3/c1-12-3-8-16-17(11-13-4-6-14(22)7-5-13)20(23)25-19(16)18-15(12)9-10-21(18,2)24/h4-7,11,16,18-19,24H,3,8-10H2,1-2H3/b17-11+/t16-,18-,19-,21+/m0/s1 |
| InChIKey | NSGTWOTUVZPSAM-OZOCIEKXSA-N |
| XLogP | 4.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|