C15H22O3 — CID 72546189
2,2,4,4-tetramethyl-6-(3-methylbutylidene)cyclohexane-1,3,5-trione (PubChem CID 72546189) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2,2,4,4-tetramethyl-6-(3-methylbutylidene)cyclohexane-1,3,5-trione.
| Compound Name | 2,2,4,4-tetramethyl-6-(3-methylbutylidene)cyclohexane-1,3,5-trione |
|---|---|
| PubChem CID | 72546189 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 2,2,4,4-tetramethyl-6-(3-methylbutylidene)cyclohexane-1,3,5-trione |
| SMILES | CC(C)CC=C1C(=O)C(C)(C)C(=O)C(C)(C)C1=O |
| InChI | InChI=1S/C15H22O3/c1-9(2)7-8-10-11(16)14(3,4)13(18)15(5,6)12(10)17/h8-9H,7H2,1-6H3 |
| InChIKey | BXDJGWQHKIRKHJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|