C21H21FO2 — CID 72546217
(3E,3aS,6aR,9aR,9bS)-3-[(2-fluorophenyl)methylidene]-6,9-dimethylidene-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-2-one (PubChem CID 72546217) has the molecular formula C21H21FO2 and a molecular weight of 324.39 g/mol. Its IUPAC name is (3E,3aS,6aR,9aR,9bS)-3-[(2-fluorophenyl)methylidene]-6,9-dimethylidene-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-2-one.
| Compound Name | (3E,3aS,6aR,9aR,9bS)-3-[(2-fluorophenyl)methylidene]-6,9-dimethylidene-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-2-one |
|---|---|
| PubChem CID | 72546217 |
| Molecular Formula | C21H21FO2 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | (3E,3aS,6aR,9aR,9bS)-3-[(2-fluorophenyl)methylidene]-6,9-dimethylidene-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-2-one |
| SMILES | C=C1CC[C@H]2C(=C)CC[C@H]3/C(=C\c4ccccc4F)C(=O)O[C@@H]3[C@@H]12 |
| InChI | InChI=1S/C21H21FO2/c1-12-7-10-16-17(11-14-5-3-4-6-18(14)22)21(23)24-20(16)19-13(2)8-9-15(12)19/h3-6,11,15-16,19-20H,1-2,7-10H2/b17-11+/t15-,16-,19-,20-/m0/s1 |
| InChIKey | XICPPEYAYAGNSM-KWUWDMCPSA-N |
| XLogP | 4.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|