C22H21F3O2 — CID 72546218
(3E,3aS,6aR,9aR,9bS)-6,9-dimethylidene-3-[[3-(trifluoromethyl)phenyl]methylidene]-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-2-one (PubChem CID 72546218) has the molecular formula C22H21F3O2 and a molecular weight of 374.40 g/mol. Its IUPAC name is (3E,3aS,6aR,9aR,9bS)-6,9-dimethylidene-3-[[3-(trifluoromethyl)phenyl]methylidene]-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-2-one.
| Compound Name | (3E,3aS,6aR,9aR,9bS)-6,9-dimethylidene-3-[[3-(trifluoromethyl)phenyl]methylidene]-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-2-one |
|---|---|
| PubChem CID | 72546218 |
| Molecular Formula | C22H21F3O2 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | (3E,3aS,6aR,9aR,9bS)-6,9-dimethylidene-3-[[3-(trifluoromethyl)phenyl]methylidene]-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-2-one |
| SMILES | C=C1CC[C@H]2C(=C)CC[C@H]3/C(=C\c4cccc(C(F)(F)F)c4)C(=O)O[C@@H]3[C@@H]12 |
| InChI | InChI=1S/C22H21F3O2/c1-12-6-9-17-18(11-14-4-3-5-15(10-14)22(23,24)25)21(26)27-20(17)19-13(2)7-8-16(12)19/h3-5,10-11,16-17,19-20H,1-2,6-9H2/b18-11+/t16-,17-,19-,20-/m0/s1 |
| InChIKey | XKQAZHWVYJUCEG-SIUFDGTASA-N |
| XLogP | 5.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|