C28H34O5 — CID 72546412
4,4-dicyclohexyl-7-phenylmethoxy-1,3-benzodioxine-2-carboxylic acid (PubChem CID 72546412) has the molecular formula C28H34O5 and a molecular weight of 450.58 g/mol. Its IUPAC name is 4,4-dicyclohexyl-7-phenylmethoxy-1,3-benzodioxine-2-carboxylic acid.
| Compound Name | 4,4-dicyclohexyl-7-phenylmethoxy-1,3-benzodioxine-2-carboxylic acid |
|---|---|
| PubChem CID | 72546412 |
| Molecular Formula | C28H34O5 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | 4,4-dicyclohexyl-7-phenylmethoxy-1,3-benzodioxine-2-carboxylic acid |
| SMILES | O=C(O)C1Oc2cc(OCc3ccccc3)ccc2C(C2CCCCC2)(C2CCCCC2)O1 |
| InChI | InChI=1S/C28H34O5/c29-26(30)27-32-25-18-23(31-19-20-10-4-1-5-11-20)16-17-24(25)28(33-27,21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1,4-5,10-11,16-18,21-22,27H,2-3,6-9,12-15,19H2,(H,29,30) |
| InChIKey | JQUBLGPIULPKCS-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |