C23H26O2 — CID 72546452
(3E,3aS,6aR,9aR,9bS)-3-[(4-ethylphenyl)methylidene]-6,9-dimethylidene-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-2-one (PubChem CID 72546452) has the molecular formula C23H26O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is (3E,3aS,6aR,9aR,9bS)-3-[(4-ethylphenyl)methylidene]-6,9-dimethylidene-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-2-one.
| Compound Name | (3E,3aS,6aR,9aR,9bS)-3-[(4-ethylphenyl)methylidene]-6,9-dimethylidene-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-2-one |
|---|---|
| PubChem CID | 72546452 |
| Molecular Formula | C23H26O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | (3E,3aS,6aR,9aR,9bS)-3-[(4-ethylphenyl)methylidene]-6,9-dimethylidene-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-2-one |
| SMILES | C=C1CC[C@H]2C(=C)CC[C@H]3/C(=C\c4ccc(CC)cc4)C(=O)O[C@@H]3[C@@H]12 |
| InChI | InChI=1S/C23H26O2/c1-4-16-7-9-17(10-8-16)13-20-19-12-5-14(2)18-11-6-15(3)21(18)22(19)25-23(20)24/h7-10,13,18-19,21-22H,2-6,11-12H2,1H3/b20-13+/t18-,19-,21-,22-/m0/s1 |
| InChIKey | RLEZGTLJSBYLMW-LFSZKHLCSA-N |
| XLogP | 5.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|