About [4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-9,10-dioxoanthracen-1-yl] 4-methylbenzenesulfonate
[4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-9,10-dioxoanthracen-1-yl] 4-methylbenzenesulfonate (PubChem CID 72546465) has the molecular formula C27H26O9S
and a molecular weight of 526.56 g/mol. Its IUPAC name is [4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-9,10-dioxoanthracen-1-yl] 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-9,10-dioxoanthracen-1-yl] 4-methylbenzenesulfonate |
| PubChem CID | 72546465 |
| Molecular Formula | C27H26O9S |
| Molecular Weight | 526.56 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | [4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-9,10-dioxoanthracen-1-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(OCCOCCOCCO)c3c2C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C27H26O9S/c1-18-6-8-19(9-7-18)37(31,32)36-23-11-10-22(35-17-16-34-15-14-33-13-12-28)24-25(23)27(30)21-5-3-2-4-20(21)26(24)29/h2-11,28H,12-17H2,1H3 |
| InChIKey | PVWRYFKFQWHYLC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 526.56 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-9,10-dioxoanthracen-1-yl] 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-9,10-dioxoanthracen-1-yl] 4-methylbenzenesulfonate?
The IUPAC name of [4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-9,10-dioxoanthracen-1-yl] 4-methylbenzenesulfonate (CID 72546465) is [4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-9,10-dioxoanthracen-1-yl] 4-methylbenzenesulfonate.
What is the SMILES notation for [4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-9,10-dioxoanthracen-1-yl] 4-methylbenzenesulfonate?
The canonical SMILES for [4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-9,10-dioxoanthracen-1-yl] 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)Oc2ccc(OCCOCCOCCO)c3c2C(=O)c2ccccc2C3=O)cc1.
What is the InChIKey of [4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-9,10-dioxoanthracen-1-yl] 4-methylbenzenesulfonate?
The InChIKey is PVWRYFKFQWHYLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H26O9S/c1-18-6-8-19(9-7-18)37(31,32)36-23-11-10-22(35-17-16-34-15-14-33-13-12-28)24-25(23)27(30)21-5-3-2-4-20(21)26(24)29/h2-11,28H,12-17H2,1H3.
What are the key properties of [4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-9,10-dioxoanthracen-1-yl] 4-methylbenzenesulfonate?
[4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-9,10-dioxoanthracen-1-yl] 4-methylbenzenesulfonate has a molecular weight of 526.56 g/mol, XLogP of 2.94, 12 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-9,10-dioxoanthracen-1-yl] 4-methylbenzenesulfonate is sourced from PubChem (CID 72546465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).