C24H29F2N5 — CID 72546529
N-[[1-(2,4-difluorophenyl)-3-(4-methylphenyl)pyrazol-4-yl]methyl]-2-(4-methylpiperazin-1-yl)ethanamine (PubChem CID 72546529) has the molecular formula C24H29F2N5 and a molecular weight of 425.53 g/mol. Its IUPAC name is N-[[1-(2,4-difluorophenyl)-3-(4-methylphenyl)pyrazol-4-yl]methyl]-2-(4-methylpiperazin-1-yl)ethanamine.
| Compound Name | N-[[1-(2,4-difluorophenyl)-3-(4-methylphenyl)pyrazol-4-yl]methyl]-2-(4-methylpiperazin-1-yl)ethanamine |
|---|---|
| PubChem CID | 72546529 |
| Molecular Formula | C24H29F2N5 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | N-[[1-(2,4-difluorophenyl)-3-(4-methylphenyl)pyrazol-4-yl]methyl]-2-(4-methylpiperazin-1-yl)ethanamine |
| SMILES | Cc1ccc(-c2nn(-c3ccc(F)cc3F)cc2CNCCN2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C24H29F2N5/c1-18-3-5-19(6-4-18)24-20(16-27-9-10-30-13-11-29(2)12-14-30)17-31(28-24)23-8-7-21(25)15-22(23)26/h3-8,15,17,27H,9-14,16H2,1-2H3 |
| InChIKey | IEAYGPILWPRSDR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|