About 6-chlorospiro[1H-indole-3,4'-piperidine]-2-one;hydrochloride
6-chlorospiro[1H-indole-3,4'-piperidine]-2-one;hydrochloride (PubChem CID 72546604) has the molecular formula C12H14Cl2N2O
and a molecular weight of 273.16 g/mol. Its IUPAC name is 6-chlorospiro[1H-indole-3,4'-piperidine]-2-one;hydrochloride.
Molecular Properties
| Compound Name | 6-chlorospiro[1H-indole-3,4'-piperidine]-2-one;hydrochloride |
| PubChem CID | 72546604 |
| Molecular Formula | C12H14Cl2N2O |
| Molecular Weight | 273.16 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 6-chlorospiro[1H-indole-3,4'-piperidine]-2-one;hydrochloride |
| SMILES | Cl.O=C1Nc2cc(Cl)ccc2C12CCNCC2 |
| InChI | InChI=1S/C12H13ClN2O.ClH/c13-8-1-2-9-10(7-8)15-11(16)12(9)3-5-14-6-4-12;/h1-2,7,14H,3-6H2,(H,15,16);1H |
| InChIKey | FZLLMWSXIJWFNQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.16 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-chlorospiro[1H-indole-3,4'-piperidine]-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chlorospiro[1H-indole-3,4'-piperidine]-2-one;hydrochloride?
The IUPAC name of 6-chlorospiro[1H-indole-3,4'-piperidine]-2-one;hydrochloride (CID 72546604) is 6-chlorospiro[1H-indole-3,4'-piperidine]-2-one;hydrochloride.
What is the SMILES notation for 6-chlorospiro[1H-indole-3,4'-piperidine]-2-one;hydrochloride?
The canonical SMILES for 6-chlorospiro[1H-indole-3,4'-piperidine]-2-one;hydrochloride is Cl.O=C1Nc2cc(Cl)ccc2C12CCNCC2.
What is the InChIKey of 6-chlorospiro[1H-indole-3,4'-piperidine]-2-one;hydrochloride?
The InChIKey is FZLLMWSXIJWFNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClN2O.ClH/c13-8-1-2-9-10(7-8)15-11(16)12(9)3-5-14-6-4-12;/h1-2,7,14H,3-6H2,(H,15,16);1H.
What are the key properties of 6-chlorospiro[1H-indole-3,4'-piperidine]-2-one;hydrochloride?
6-chlorospiro[1H-indole-3,4'-piperidine]-2-one;hydrochloride has a molecular weight of 273.16 g/mol, XLogP of 2.34, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chlorospiro[1H-indole-3,4'-piperidine]-2-one;hydrochloride is sourced from PubChem (CID 72546604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).