About 3-piperidin-1-ylpropyl N'-[4-(4-cyanophenyl)butyl]carbamimidothioate
3-piperidin-1-ylpropyl N'-[4-(4-cyanophenyl)butyl]carbamimidothioate (PubChem CID 72546762) has the molecular formula C20H30N4S
and a molecular weight of 358.56 g/mol. Its IUPAC name is 3-piperidin-1-ylpropyl N'-[4-(4-cyanophenyl)butyl]carbamimidothioate.
Molecular Properties
| Compound Name | 3-piperidin-1-ylpropyl N'-[4-(4-cyanophenyl)butyl]carbamimidothioate |
| PubChem CID | 72546762 |
| Molecular Formula | C20H30N4S |
| Molecular Weight | 358.56 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | 3-piperidin-1-ylpropyl N'-[4-(4-cyanophenyl)butyl]carbamimidothioate |
| SMILES | N#Cc1ccc(CCCC/N=C(/N)SCCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C20H30N4S/c21-17-19-10-8-18(9-11-19)7-2-3-12-23-20(22)25-16-6-15-24-13-4-1-5-14-24/h8-11H,1-7,12-16H2,(H2,22,23) |
| InChIKey | GUHUDRUICITKLL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 65.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.56 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-piperidin-1-ylpropyl N'-[4-(4-cyanophenyl)butyl]carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-piperidin-1-ylpropyl N'-[4-(4-cyanophenyl)butyl]carbamimidothioate?
The IUPAC name of 3-piperidin-1-ylpropyl N'-[4-(4-cyanophenyl)butyl]carbamimidothioate (CID 72546762) is 3-piperidin-1-ylpropyl N'-[4-(4-cyanophenyl)butyl]carbamimidothioate.
What is the SMILES notation for 3-piperidin-1-ylpropyl N'-[4-(4-cyanophenyl)butyl]carbamimidothioate?
The canonical SMILES for 3-piperidin-1-ylpropyl N'-[4-(4-cyanophenyl)butyl]carbamimidothioate is N#Cc1ccc(CCCC/N=C(/N)SCCCN2CCCCC2)cc1.
What is the InChIKey of 3-piperidin-1-ylpropyl N'-[4-(4-cyanophenyl)butyl]carbamimidothioate?
The InChIKey is GUHUDRUICITKLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30N4S/c21-17-19-10-8-18(9-11-19)7-2-3-12-23-20(22)25-16-6-15-24-13-4-1-5-14-24/h8-11H,1-7,12-16H2,(H2,22,23).
What are the key properties of 3-piperidin-1-ylpropyl N'-[4-(4-cyanophenyl)butyl]carbamimidothioate?
3-piperidin-1-ylpropyl N'-[4-(4-cyanophenyl)butyl]carbamimidothioate has a molecular weight of 358.56 g/mol, XLogP of 3.80, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-piperidin-1-ylpropyl N'-[4-(4-cyanophenyl)butyl]carbamimidothioate is sourced from PubChem (CID 72546762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).