C30H34N2O2 — CID 72546987
(1R,2R,4R)-N-benzhydryl-4-morpholin-4-yl-2-phenylcyclohexane-1-carboxamide (PubChem CID 72546987) has the molecular formula C30H34N2O2 and a molecular weight of 454.61 g/mol. Its IUPAC name is (1R,2R,4R)-N-benzhydryl-4-morpholin-4-yl-2-phenylcyclohexane-1-carboxamide.
| Compound Name | (1R,2R,4R)-N-benzhydryl-4-morpholin-4-yl-2-phenylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 72546987 |
| Molecular Formula | C30H34N2O2 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | (1R,2R,4R)-N-benzhydryl-4-morpholin-4-yl-2-phenylcyclohexane-1-carboxamide |
| SMILES | O=C(NC(c1ccccc1)c1ccccc1)[C@@H]1CC[C@@H](N2CCOCC2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C30H34N2O2/c33-30(31-29(24-12-6-2-7-13-24)25-14-8-3-9-15-25)27-17-16-26(32-18-20-34-21-19-32)22-28(27)23-10-4-1-5-11-23/h1-15,26-29H,16-22H2,(H,31,33)/t26-,27-,28+/m1/s1 |
| InChIKey | UYLZHMAXLJBXOB-FCEKVYKBSA-N |
| XLogP | 5.18 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |