About (3S)-3,4-dibenzyl-1-oxa-4-azaspiro[5.5]undecan-2-one
(3S)-3,4-dibenzyl-1-oxa-4-azaspiro[5.5]undecan-2-one (PubChem CID 72547005) has the molecular formula C23H27NO2
and a molecular weight of 349.47 g/mol. Its IUPAC name is (3S)-3,4-dibenzyl-1-oxa-4-azaspiro[5.5]undecan-2-one.
Molecular Properties
| Compound Name | (3S)-3,4-dibenzyl-1-oxa-4-azaspiro[5.5]undecan-2-one |
| PubChem CID | 72547005 |
| Molecular Formula | C23H27NO2 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | (3S)-3,4-dibenzyl-1-oxa-4-azaspiro[5.5]undecan-2-one |
| SMILES | O=C1OC2(CCCCC2)CN(Cc2ccccc2)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C23H27NO2/c25-22-21(16-19-10-4-1-5-11-19)24(17-20-12-6-2-7-13-20)18-23(26-22)14-8-3-9-15-23/h1-2,4-7,10-13,21H,3,8-9,14-18H2/t21-/m0/s1 |
| InChIKey | LAILGRMGOOTHNT-NRFANRHFSA-N |
| XLogP | 4.36 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-3,4-dibenzyl-1-oxa-4-azaspiro[5.5]undecan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3,4-dibenzyl-1-oxa-4-azaspiro[5.5]undecan-2-one?
The IUPAC name of (3S)-3,4-dibenzyl-1-oxa-4-azaspiro[5.5]undecan-2-one (CID 72547005) is (3S)-3,4-dibenzyl-1-oxa-4-azaspiro[5.5]undecan-2-one.
What is the SMILES notation for (3S)-3,4-dibenzyl-1-oxa-4-azaspiro[5.5]undecan-2-one?
The canonical SMILES for (3S)-3,4-dibenzyl-1-oxa-4-azaspiro[5.5]undecan-2-one is O=C1OC2(CCCCC2)CN(Cc2ccccc2)[C@H]1Cc1ccccc1.
What is the InChIKey of (3S)-3,4-dibenzyl-1-oxa-4-azaspiro[5.5]undecan-2-one?
The InChIKey is LAILGRMGOOTHNT-NRFANRHFSA-N. The full InChI is InChI=1S/C23H27NO2/c25-22-21(16-19-10-4-1-5-11-19)24(17-20-12-6-2-7-13-20)18-23(26-22)14-8-3-9-15-23/h1-2,4-7,10-13,21H,3,8-9,14-18H2/t21-/m0/s1.
What are the key properties of (3S)-3,4-dibenzyl-1-oxa-4-azaspiro[5.5]undecan-2-one?
(3S)-3,4-dibenzyl-1-oxa-4-azaspiro[5.5]undecan-2-one has a molecular weight of 349.47 g/mol, XLogP of 4.36, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3,4-dibenzyl-1-oxa-4-azaspiro[5.5]undecan-2-one is sourced from PubChem (CID 72547005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).