About 4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]phenol
4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]phenol (PubChem CID 72547280) has the molecular formula C9H8ClN5O
and a molecular weight of 237.65 g/mol. Its IUPAC name is 4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]phenol.
Molecular Properties
| Compound Name | 4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]phenol |
| PubChem CID | 72547280 |
| Molecular Formula | C9H8ClN5O |
| Molecular Weight | 237.65 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | 4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]phenol |
| SMILES | Nc1nc(Cl)nc(Nc2ccc(O)cc2)n1 |
| InChI | InChI=1S/C9H8ClN5O/c10-7-13-8(11)15-9(14-7)12-5-1-3-6(16)4-2-5/h1-4,16H,(H3,11,12,13,14,15) |
| InChIKey | MJFJFEHMDGMEJD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.65 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]phenol?
The IUPAC name of 4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]phenol (CID 72547280) is 4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]phenol.
What is the SMILES notation for 4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]phenol?
The canonical SMILES for 4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]phenol is Nc1nc(Cl)nc(Nc2ccc(O)cc2)n1.
What is the InChIKey of 4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]phenol?
The InChIKey is MJFJFEHMDGMEJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClN5O/c10-7-13-8(11)15-9(14-7)12-5-1-3-6(16)4-2-5/h1-4,16H,(H3,11,12,13,14,15).
What are the key properties of 4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]phenol?
4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]phenol has a molecular weight of 237.65 g/mol, XLogP of 1.56, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]phenol is sourced from PubChem (CID 72547280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).