About 6-[(1S)-1-(benzylamino)ethyl]-2,2-dimethylchromen-7-ol
6-[(1S)-1-(benzylamino)ethyl]-2,2-dimethylchromen-7-ol (PubChem CID 72547485) has the molecular formula C20H23NO2
and a molecular weight of 309.41 g/mol. Its IUPAC name is 6-[(1S)-1-(benzylamino)ethyl]-2,2-dimethylchromen-7-ol.
Molecular Properties
| Compound Name | 6-[(1S)-1-(benzylamino)ethyl]-2,2-dimethylchromen-7-ol |
| PubChem CID | 72547485 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 6-[(1S)-1-(benzylamino)ethyl]-2,2-dimethylchromen-7-ol |
| SMILES | C[C@H](NCc1ccccc1)c1cc2c(cc1O)OC(C)(C)C=C2 |
| InChI | InChI=1S/C20H23NO2/c1-14(21-13-15-7-5-4-6-8-15)17-11-16-9-10-20(2,3)23-19(16)12-18(17)22/h4-12,14,21-22H,13H2,1-3H3/t14-/m0/s1 |
| InChIKey | BKTBRJMYHRKCFT-AWEZNQCLSA-N |
| XLogP | 4.43 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 6-[(1S)-1-(benzylamino)ethyl]-2,2-dimethylchromen-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(1S)-1-(benzylamino)ethyl]-2,2-dimethylchromen-7-ol?
The IUPAC name of 6-[(1S)-1-(benzylamino)ethyl]-2,2-dimethylchromen-7-ol (CID 72547485) is 6-[(1S)-1-(benzylamino)ethyl]-2,2-dimethylchromen-7-ol.
What is the SMILES notation for 6-[(1S)-1-(benzylamino)ethyl]-2,2-dimethylchromen-7-ol?
The canonical SMILES for 6-[(1S)-1-(benzylamino)ethyl]-2,2-dimethylchromen-7-ol is C[C@H](NCc1ccccc1)c1cc2c(cc1O)OC(C)(C)C=C2.
What is the InChIKey of 6-[(1S)-1-(benzylamino)ethyl]-2,2-dimethylchromen-7-ol?
The InChIKey is BKTBRJMYHRKCFT-AWEZNQCLSA-N. The full InChI is InChI=1S/C20H23NO2/c1-14(21-13-15-7-5-4-6-8-15)17-11-16-9-10-20(2,3)23-19(16)12-18(17)22/h4-12,14,21-22H,13H2,1-3H3/t14-/m0/s1.
What are the key properties of 6-[(1S)-1-(benzylamino)ethyl]-2,2-dimethylchromen-7-ol?
6-[(1S)-1-(benzylamino)ethyl]-2,2-dimethylchromen-7-ol has a molecular weight of 309.41 g/mol, XLogP of 4.43, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(1S)-1-(benzylamino)ethyl]-2,2-dimethylchromen-7-ol is sourced from PubChem (CID 72547485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).