About [(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-hydroxymethanesulfonic acid
[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-hydroxymethanesulfonic acid (PubChem CID 72547611) has the molecular formula C9H16O6S
and a molecular weight of 252.29 g/mol. Its IUPAC name is [(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-hydroxymethanesulfonic acid.
Molecular Properties
| Compound Name | [(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-hydroxymethanesulfonic acid |
| PubChem CID | 72547611 |
| Molecular Formula | C9H16O6S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | [(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-hydroxymethanesulfonic acid |
| SMILES | O=S(=O)(O)C(O)[C@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C9H16O6S/c10-8(16(11,12)13)7-6-14-9(15-7)4-2-1-3-5-9/h7-8,10H,1-6H2,(H,11,12,13)/t7-,8?/m1/s1 |
| InChIKey | RPNGREIQRWICMO-GVHYBUMESA-N |
| XLogP | 0.27 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze [(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-hydroxymethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-hydroxymethanesulfonic acid?
The IUPAC name of [(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-hydroxymethanesulfonic acid (CID 72547611) is [(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-hydroxymethanesulfonic acid.
What is the SMILES notation for [(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-hydroxymethanesulfonic acid?
The canonical SMILES for [(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-hydroxymethanesulfonic acid is O=S(=O)(O)C(O)[C@H]1COC2(CCCCC2)O1.
What is the InChIKey of [(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-hydroxymethanesulfonic acid?
The InChIKey is RPNGREIQRWICMO-GVHYBUMESA-N. The full InChI is InChI=1S/C9H16O6S/c10-8(16(11,12)13)7-6-14-9(15-7)4-2-1-3-5-9/h7-8,10H,1-6H2,(H,11,12,13)/t7-,8?/m1/s1.
What are the key properties of [(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-hydroxymethanesulfonic acid?
[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-hydroxymethanesulfonic acid has a molecular weight of 252.29 g/mol, XLogP of 0.27, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-hydroxymethanesulfonic acid is sourced from PubChem (CID 72547611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).