About (4-chlorophenyl)-[1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidin-4-yl]methanol
(4-chlorophenyl)-[1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidin-4-yl]methanol (PubChem CID 72547676) has the molecular formula C18H24ClN3O3S
and a molecular weight of 397.93 g/mol. Its IUPAC name is (4-chlorophenyl)-[1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidin-4-yl]methanol.
Molecular Properties
| Compound Name | (4-chlorophenyl)-[1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidin-4-yl]methanol |
| PubChem CID | 72547676 |
| Molecular Formula | C18H24ClN3O3S |
| Molecular Weight | 397.93 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | (4-chlorophenyl)-[1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidin-4-yl]methanol |
| SMILES | Cc1nn(C)c(C)c1S(=O)(=O)N1CCC(C(O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C18H24ClN3O3S/c1-12-18(13(2)21(3)20-12)26(24,25)22-10-8-15(9-11-22)17(23)14-4-6-16(19)7-5-14/h4-7,15,17,23H,8-11H2,1-3H3 |
| InChIKey | PFKDEFOFHVHIEO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.93 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-chlorophenyl)-[1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)-[1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidin-4-yl]methanol?
The IUPAC name of (4-chlorophenyl)-[1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidin-4-yl]methanol (CID 72547676) is (4-chlorophenyl)-[1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidin-4-yl]methanol.
What is the SMILES notation for (4-chlorophenyl)-[1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidin-4-yl]methanol?
The canonical SMILES for (4-chlorophenyl)-[1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidin-4-yl]methanol is Cc1nn(C)c(C)c1S(=O)(=O)N1CCC(C(O)c2ccc(Cl)cc2)CC1.
What is the InChIKey of (4-chlorophenyl)-[1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidin-4-yl]methanol?
The InChIKey is PFKDEFOFHVHIEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24ClN3O3S/c1-12-18(13(2)21(3)20-12)26(24,25)22-10-8-15(9-11-22)17(23)14-4-6-16(19)7-5-14/h4-7,15,17,23H,8-11H2,1-3H3.
What are the key properties of (4-chlorophenyl)-[1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidin-4-yl]methanol?
(4-chlorophenyl)-[1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidin-4-yl]methanol has a molecular weight of 397.93 g/mol, XLogP of 2.82, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)-[1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidin-4-yl]methanol is sourced from PubChem (CID 72547676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).