C28H21F3N4O3S — CID 72547740
[(4aR)-6-(3,5-difluorophenyl)sulfonyl-1-(4-fluorophenyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-pyridin-2-ylmethanone (PubChem CID 72547740) has the molecular formula C28H21F3N4O3S and a molecular weight of 550.56 g/mol. Its IUPAC name is [(4aR)-6-(3,5-difluorophenyl)sulfonyl-1-(4-fluorophenyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-pyridin-2-ylmethanone.
| Compound Name | [(4aR)-6-(3,5-difluorophenyl)sulfonyl-1-(4-fluorophenyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 72547740 |
| Molecular Formula | C28H21F3N4O3S |
| Molecular Weight | 550.56 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | [(4aR)-6-(3,5-difluorophenyl)sulfonyl-1-(4-fluorophenyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-pyridin-2-ylmethanone |
| SMILES | O=C(c1ccccn1)[C@]12Cc3cnn(-c4ccc(F)cc4)c3C=C1CCN(S(=O)(=O)c1cc(F)cc(F)c1)C2 |
| InChI | InChI=1S/C28H21F3N4O3S/c29-20-4-6-23(7-5-20)35-26-11-19-8-10-34(39(37,38)24-13-21(30)12-22(31)14-24)17-28(19,15-18(26)16-33-35)27(36)25-3-1-2-9-32-25/h1-7,9,11-14,16H,8,10,15,17H2/t28-/m0/s1 |
| InChIKey | GBWUCPKZMQZIPT-NDEPHWFRSA-N |
| XLogP | 4.59 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.56 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |