C27H23FN4O3S2 — CID 72547742
[(4aR)-1-(4-fluorophenyl)-6-(4-methylphenyl)sulfonyl-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-4-yl)methanone (PubChem CID 72547742) has the molecular formula C27H23FN4O3S2 and a molecular weight of 534.64 g/mol. Its IUPAC name is [(4aR)-1-(4-fluorophenyl)-6-(4-methylphenyl)sulfonyl-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-4-yl)methanone.
| Compound Name | [(4aR)-1-(4-fluorophenyl)-6-(4-methylphenyl)sulfonyl-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 72547742 |
| Molecular Formula | C27H23FN4O3S2 |
| Molecular Weight | 534.64 g/mol |
| Exact Mass | 534.12 |
| IUPAC Name | [(4aR)-1-(4-fluorophenyl)-6-(4-methylphenyl)sulfonyl-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-4-yl)methanone |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC3=Cc4c(cnn4-c4ccc(F)cc4)C[C@]3(C(=O)c3cscn3)C2)cc1 |
| InChI | InChI=1S/C27H23FN4O3S2/c1-18-2-8-23(9-3-18)37(34,35)31-11-10-20-12-25-19(14-30-32(25)22-6-4-21(28)5-7-22)13-27(20,16-31)26(33)24-15-36-17-29-24/h2-9,12,14-15,17H,10-11,13,16H2,1H3/t27-/m0/s1 |
| InChIKey | WZGSECGDLIRWAZ-MHZLTWQESA-N |
| XLogP | 4.68 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.64 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |