About 2-(4-fluoro-3-methoxyphenyl)-4,5-dihydroxybenzene-1,3-dicarbonitrile
2-(4-fluoro-3-methoxyphenyl)-4,5-dihydroxybenzene-1,3-dicarbonitrile (PubChem CID 72547797) has the molecular formula C15H9FN2O3
and a molecular weight of 284.25 g/mol. Its IUPAC name is 2-(4-fluoro-3-methoxyphenyl)-4,5-dihydroxybenzene-1,3-dicarbonitrile.
Molecular Properties
| Compound Name | 2-(4-fluoro-3-methoxyphenyl)-4,5-dihydroxybenzene-1,3-dicarbonitrile |
| PubChem CID | 72547797 |
| Molecular Formula | C15H9FN2O3 |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 2-(4-fluoro-3-methoxyphenyl)-4,5-dihydroxybenzene-1,3-dicarbonitrile |
| SMILES | COc1cc(-c2c(C#N)cc(O)c(O)c2C#N)ccc1F |
| InChI | InChI=1S/C15H9FN2O3/c1-21-13-5-8(2-3-11(13)16)14-9(6-17)4-12(19)15(20)10(14)7-18/h2-5,19-20H,1H3 |
| InChIKey | BSOFKRUNZCXJRX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-fluoro-3-methoxyphenyl)-4,5-dihydroxybenzene-1,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluoro-3-methoxyphenyl)-4,5-dihydroxybenzene-1,3-dicarbonitrile?
The IUPAC name of 2-(4-fluoro-3-methoxyphenyl)-4,5-dihydroxybenzene-1,3-dicarbonitrile (CID 72547797) is 2-(4-fluoro-3-methoxyphenyl)-4,5-dihydroxybenzene-1,3-dicarbonitrile.
What is the SMILES notation for 2-(4-fluoro-3-methoxyphenyl)-4,5-dihydroxybenzene-1,3-dicarbonitrile?
The canonical SMILES for 2-(4-fluoro-3-methoxyphenyl)-4,5-dihydroxybenzene-1,3-dicarbonitrile is COc1cc(-c2c(C#N)cc(O)c(O)c2C#N)ccc1F.
What is the InChIKey of 2-(4-fluoro-3-methoxyphenyl)-4,5-dihydroxybenzene-1,3-dicarbonitrile?
The InChIKey is BSOFKRUNZCXJRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9FN2O3/c1-21-13-5-8(2-3-11(13)16)14-9(6-17)4-12(19)15(20)10(14)7-18/h2-5,19-20H,1H3.
What are the key properties of 2-(4-fluoro-3-methoxyphenyl)-4,5-dihydroxybenzene-1,3-dicarbonitrile?
2-(4-fluoro-3-methoxyphenyl)-4,5-dihydroxybenzene-1,3-dicarbonitrile has a molecular weight of 284.25 g/mol, XLogP of 2.66, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluoro-3-methoxyphenyl)-4,5-dihydroxybenzene-1,3-dicarbonitrile is sourced from PubChem (CID 72547797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).