C23H26N6O4S — CID 72547856
N-(3-methylsulfonylpropyl)-4-[(1-oxo-2,3-dihydroisoindol-4-yl)amino]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide (PubChem CID 72547856) has the molecular formula C23H26N6O4S and a molecular weight of 482.57 g/mol. Its IUPAC name is N-(3-methylsulfonylpropyl)-4-[(1-oxo-2,3-dihydroisoindol-4-yl)amino]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide.
| Compound Name | N-(3-methylsulfonylpropyl)-4-[(1-oxo-2,3-dihydroisoindol-4-yl)amino]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide |
|---|---|
| PubChem CID | 72547856 |
| Molecular Formula | C23H26N6O4S |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | N-(3-methylsulfonylpropyl)-4-[(1-oxo-2,3-dihydroisoindol-4-yl)amino]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide |
| SMILES | CS(=O)(=O)CCCNC(=O)C1CCc2[nH]c3ncnc(Nc4cccc5c4CNC5=O)c3c2C1 |
| InChI | InChI=1S/C23H26N6O4S/c1-34(32,33)9-3-8-24-22(30)13-6-7-18-15(10-13)19-20(26-12-27-21(19)29-18)28-17-5-2-4-14-16(17)11-25-23(14)31/h2,4-5,12-13H,3,6-11H2,1H3,(H,24,30)(H,25,31)(H2,26,27,28,29) |
| InChIKey | WBCJYKPJFIAKSR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 145.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|