C26H26F3N5O2 — CID 72547966
N-[4-[(1R,3R,4R,5S)-4-acetamido-3-amino-5-methylcyclohexyl]-3-pyridinyl]-6-(2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide (PubChem CID 72547966) has the molecular formula C26H26F3N5O2 and a molecular weight of 497.52 g/mol. Its IUPAC name is N-[4-[(1R,3R,4R,5S)-4-acetamido-3-amino-5-methylcyclohexyl]-3-pyridinyl]-6-(2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide.
| Compound Name | N-[4-[(1R,3R,4R,5S)-4-acetamido-3-amino-5-methylcyclohexyl]-3-pyridinyl]-6-(2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 72547966 |
| Molecular Formula | C26H26F3N5O2 |
| Molecular Weight | 497.52 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | N-[4-[(1R,3R,4R,5S)-4-acetamido-3-amino-5-methylcyclohexyl]-3-pyridinyl]-6-(2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide |
| SMILES | CC(=O)N[C@H]1[C@H](N)C[C@H](c2ccncc2NC(=O)c2ccc(F)c(-c3c(F)cccc3F)n2)C[C@@H]1C |
| InChI | InChI=1S/C26H26F3N5O2/c1-13-10-15(11-20(30)24(13)32-14(2)35)16-8-9-31-12-22(16)34-26(36)21-7-6-19(29)25(33-21)23-17(27)4-3-5-18(23)28/h3-9,12-13,15,20,24H,10-11,30H2,1-2H3,(H,32,35)(H,34,36)/t13-,15+,20+,24+/m0/s1 |
| InChIKey | HXUHHDBYIBYXPB-ASRFMACQSA-N |
| XLogP | 4.16 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |