C25H19ClFN5O3S2 — CID 72548208
[(4aR)-6-[(6-chloro-3-pyridinyl)sulfonyl]-1-(4-fluorophenyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-2-yl)methanone (PubChem CID 72548208) has the molecular formula C25H19ClFN5O3S2 and a molecular weight of 556.04 g/mol. Its IUPAC name is [(4aR)-6-[(6-chloro-3-pyridinyl)sulfonyl]-1-(4-fluorophenyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-2-yl)methanone.
| Compound Name | [(4aR)-6-[(6-chloro-3-pyridinyl)sulfonyl]-1-(4-fluorophenyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-2-yl)methanone |
|---|---|
| PubChem CID | 72548208 |
| Molecular Formula | C25H19ClFN5O3S2 |
| Molecular Weight | 556.04 g/mol |
| Exact Mass | 555.06 |
| IUPAC Name | [(4aR)-6-[(6-chloro-3-pyridinyl)sulfonyl]-1-(4-fluorophenyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-2-yl)methanone |
| SMILES | O=C(c1nccs1)[C@]12Cc3cnn(-c4ccc(F)cc4)c3C=C1CCN(S(=O)(=O)c1ccc(Cl)nc1)C2 |
| InChI | InChI=1S/C25H19ClFN5O3S2/c26-22-6-5-20(14-29-22)37(34,35)31-9-7-17-11-21-16(13-30-32(21)19-3-1-18(27)2-4-19)12-25(17,15-31)23(33)24-28-8-10-36-24/h1-6,8,10-11,13-14H,7,9,12,15H2/t25-/m0/s1 |
| InChIKey | RRHFNAIGVSLEBM-VWLOTQADSA-N |
| XLogP | 4.42 |
| TPSA | 98.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.04 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|