C28H31F3N4O3 — CID 72548436
N-[4-[(1R,3R,4S,5S)-3-amino-4-methoxy-5-methylcyclohexyl]-3-pyridinyl]-6-[4-(ethoxymethyl)-2,6-difluorophenyl]-5-fluoropyridine-2-carboxamide (PubChem CID 72548436) has the molecular formula C28H31F3N4O3 and a molecular weight of 528.58 g/mol. Its IUPAC name is N-[4-[(1R,3R,4S,5S)-3-amino-4-methoxy-5-methylcyclohexyl]-3-pyridinyl]-6-[4-(ethoxymethyl)-2,6-difluorophenyl]-5-fluoropyridine-2-carboxamide.
| Compound Name | N-[4-[(1R,3R,4S,5S)-3-amino-4-methoxy-5-methylcyclohexyl]-3-pyridinyl]-6-[4-(ethoxymethyl)-2,6-difluorophenyl]-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 72548436 |
| Molecular Formula | C28H31F3N4O3 |
| Molecular Weight | 528.58 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | N-[4-[(1R,3R,4S,5S)-3-amino-4-methoxy-5-methylcyclohexyl]-3-pyridinyl]-6-[4-(ethoxymethyl)-2,6-difluorophenyl]-5-fluoropyridine-2-carboxamide |
| SMILES | CCOCc1cc(F)c(-c2nc(C(=O)Nc3cnccc3[C@H]3C[C@@H](N)[C@@H](OC)[C@@H](C)C3)ccc2F)c(F)c1 |
| InChI | InChI=1S/C28H31F3N4O3/c1-4-38-14-16-10-20(30)25(21(31)11-16)26-19(29)5-6-23(34-26)28(36)35-24-13-33-8-7-18(24)17-9-15(2)27(37-3)22(32)12-17/h5-8,10-11,13,15,17,22,27H,4,9,12,14,32H2,1-3H3,(H,35,36)/t15-,17+,22+,27-/m0/s1 |
| InChIKey | MMOSRHUYBPJLSR-XNTIZDRCSA-N |
| XLogP | 5.21 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.58 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |