C26H22FN3O4S — CID 72548550
2-(4-ethylsulfonylphenyl)-N-[3-(3-fluorophenoxy)-4-pyrimidin-5-ylphenyl]acetamide (PubChem CID 72548550) has the molecular formula C26H22FN3O4S and a molecular weight of 491.54 g/mol. Its IUPAC name is 2-(4-ethylsulfonylphenyl)-N-[3-(3-fluorophenoxy)-4-pyrimidin-5-ylphenyl]acetamide.
| Compound Name | 2-(4-ethylsulfonylphenyl)-N-[3-(3-fluorophenoxy)-4-pyrimidin-5-ylphenyl]acetamide |
|---|---|
| PubChem CID | 72548550 |
| Molecular Formula | C26H22FN3O4S |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | 2-(4-ethylsulfonylphenyl)-N-[3-(3-fluorophenoxy)-4-pyrimidin-5-ylphenyl]acetamide |
| SMILES | CCS(=O)(=O)c1ccc(CC(=O)Nc2ccc(-c3cncnc3)c(Oc3cccc(F)c3)c2)cc1 |
| InChI | InChI=1S/C26H22FN3O4S/c1-2-35(32,33)23-9-6-18(7-10-23)12-26(31)30-21-8-11-24(19-15-28-17-29-16-19)25(14-21)34-22-5-3-4-20(27)13-22/h3-11,13-17H,2,12H2,1H3,(H,30,31) |
| InChIKey | PTQXAOAFFHVIFO-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |