C30H32F4N4O3 — CID 72548663
N-[4-[(1R,3R,4S,5S)-3-amino-4-methoxy-5-methylcyclohexyl]-3-pyridinyl]-6-[2,6-difluoro-4-(4-fluorooxan-4-yl)phenyl]-5-fluoropyridine-2-carboxamide (PubChem CID 72548663) has the molecular formula C30H32F4N4O3 and a molecular weight of 572.60 g/mol. Its IUPAC name is N-[4-[(1R,3R,4S,5S)-3-amino-4-methoxy-5-methylcyclohexyl]-3-pyridinyl]-6-[2,6-difluoro-4-(4-fluorooxan-4-yl)phenyl]-5-fluoropyridine-2-carboxamide.
| Compound Name | N-[4-[(1R,3R,4S,5S)-3-amino-4-methoxy-5-methylcyclohexyl]-3-pyridinyl]-6-[2,6-difluoro-4-(4-fluorooxan-4-yl)phenyl]-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 72548663 |
| Molecular Formula | C30H32F4N4O3 |
| Molecular Weight | 572.60 g/mol |
| Exact Mass | 572.24 |
| IUPAC Name | N-[4-[(1R,3R,4S,5S)-3-amino-4-methoxy-5-methylcyclohexyl]-3-pyridinyl]-6-[2,6-difluoro-4-(4-fluorooxan-4-yl)phenyl]-5-fluoropyridine-2-carboxamide |
| SMILES | CO[C@@H]1[C@H](N)C[C@H](c2ccncc2NC(=O)c2ccc(F)c(-c3c(F)cc(C4(F)CCOCC4)cc3F)n2)C[C@@H]1C |
| InChI | InChI=1S/C30H32F4N4O3/c1-16-11-17(12-23(35)28(16)40-2)19-5-8-36-15-25(19)38-29(39)24-4-3-20(31)27(37-24)26-21(32)13-18(14-22(26)33)30(34)6-9-41-10-7-30/h3-5,8,13-17,23,28H,6-7,9-12,35H2,1-2H3,(H,38,39)/t16-,17+,23+,28-/m0/s1 |
| InChIKey | ZCTSKEOHMXXIST-HQXPOKEDSA-N |
| XLogP | 5.64 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.60 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |