C28H31F3N4O2 — CID 72548664
N-[4-[(1R,3R,4S,5S)-3-amino-4-methoxy-5-methylcyclohexyl]-3-pyridinyl]-6-(2,6-difluoro-4-propan-2-ylphenyl)-5-fluoropyridine-2-carboxamide (PubChem CID 72548664) has the molecular formula C28H31F3N4O2 and a molecular weight of 512.58 g/mol. Its IUPAC name is N-[4-[(1R,3R,4S,5S)-3-amino-4-methoxy-5-methylcyclohexyl]-3-pyridinyl]-6-(2,6-difluoro-4-propan-2-ylphenyl)-5-fluoropyridine-2-carboxamide.
| Compound Name | N-[4-[(1R,3R,4S,5S)-3-amino-4-methoxy-5-methylcyclohexyl]-3-pyridinyl]-6-(2,6-difluoro-4-propan-2-ylphenyl)-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 72548664 |
| Molecular Formula | C28H31F3N4O2 |
| Molecular Weight | 512.58 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | N-[4-[(1R,3R,4S,5S)-3-amino-4-methoxy-5-methylcyclohexyl]-3-pyridinyl]-6-(2,6-difluoro-4-propan-2-ylphenyl)-5-fluoropyridine-2-carboxamide |
| SMILES | CO[C@@H]1[C@H](N)C[C@H](c2ccncc2NC(=O)c2ccc(F)c(-c3c(F)cc(C(C)C)cc3F)n2)C[C@@H]1C |
| InChI | InChI=1S/C28H31F3N4O2/c1-14(2)16-10-20(30)25(21(31)11-16)26-19(29)5-6-23(34-26)28(36)35-24-13-33-8-7-18(24)17-9-15(3)27(37-4)22(32)12-17/h5-8,10-11,13-15,17,22,27H,9,12,32H2,1-4H3,(H,35,36)/t15-,17+,22+,27-/m0/s1 |
| InChIKey | KEQAECANTREWKS-XNTIZDRCSA-N |
| XLogP | 5.79 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.58 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |