C28H30F3N5O2 — CID 72548667
N-[4-[(1R,3R,4S,5S)-3-amino-5-methyl-4-(2-methylpropanoylamino)cyclohexyl]-3-pyridinyl]-6-(2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide (PubChem CID 72548667) has the molecular formula C28H30F3N5O2 and a molecular weight of 525.58 g/mol. Its IUPAC name is N-[4-[(1R,3R,4S,5S)-3-amino-5-methyl-4-(2-methylpropanoylamino)cyclohexyl]-3-pyridinyl]-6-(2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide.
| Compound Name | N-[4-[(1R,3R,4S,5S)-3-amino-5-methyl-4-(2-methylpropanoylamino)cyclohexyl]-3-pyridinyl]-6-(2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 72548667 |
| Molecular Formula | C28H30F3N5O2 |
| Molecular Weight | 525.58 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | N-[4-[(1R,3R,4S,5S)-3-amino-5-methyl-4-(2-methylpropanoylamino)cyclohexyl]-3-pyridinyl]-6-(2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide |
| SMILES | CC(C)C(=O)N[C@@H]1[C@H](N)C[C@H](c2ccncc2NC(=O)c2ccc(F)c(-c3c(F)cccc3F)n2)C[C@@H]1C |
| InChI | InChI=1S/C28H30F3N5O2/c1-14(2)27(37)36-25-15(3)11-16(12-21(25)32)17-9-10-33-13-23(17)35-28(38)22-8-7-20(31)26(34-22)24-18(29)5-4-6-19(24)30/h4-10,13-16,21,25H,11-12,32H2,1-3H3,(H,35,38)(H,36,37)/t15-,16+,21+,25-/m0/s1 |
| InChIKey | RXIVHKXXRWBNDH-CSMVMILBSA-N |
| XLogP | 4.79 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.58 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |