C28H37N3O2 — CID 72548833
(2S)-N-[(2R)-1-phenylpropan-2-yl]-2-[[(E)-3-phenylprop-2-enoyl]amino]-5-piperidin-1-ylpentanamide (PubChem CID 72548833) has the molecular formula C28H37N3O2 and a molecular weight of 447.62 g/mol. Its IUPAC name is (2S)-N-[(2R)-1-phenylpropan-2-yl]-2-[[(E)-3-phenylprop-2-enoyl]amino]-5-piperidin-1-ylpentanamide.
| Compound Name | (2S)-N-[(2R)-1-phenylpropan-2-yl]-2-[[(E)-3-phenylprop-2-enoyl]amino]-5-piperidin-1-ylpentanamide |
|---|---|
| PubChem CID | 72548833 |
| Molecular Formula | C28H37N3O2 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.29 |
| IUPAC Name | (2S)-N-[(2R)-1-phenylpropan-2-yl]-2-[[(E)-3-phenylprop-2-enoyl]amino]-5-piperidin-1-ylpentanamide |
| SMILES | C[C@H](Cc1ccccc1)NC(=O)[C@H](CCCN1CCCCC1)NC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C28H37N3O2/c1-23(22-25-14-7-3-8-15-25)29-28(33)26(16-11-21-31-19-9-4-10-20-31)30-27(32)18-17-24-12-5-2-6-13-24/h2-3,5-8,12-15,17-18,23,26H,4,9-11,16,19-22H2,1H3,(H,29,33)(H,30,32)/b18-17+/t23-,26+/m1/s1 |
| InChIKey | IUCHGXSYSMFYEV-HNBICEFVSA-N |
| XLogP | 4.20 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|