C26H20F2N4O3S2 — CID 72548923
[(4aR)-1-(4-fluorophenyl)-6-(3-fluorophenyl)sulfonyl-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-2-yl)methanone (PubChem CID 72548923) has the molecular formula C26H20F2N4O3S2 and a molecular weight of 538.60 g/mol. Its IUPAC name is [(4aR)-1-(4-fluorophenyl)-6-(3-fluorophenyl)sulfonyl-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-2-yl)methanone.
| Compound Name | [(4aR)-1-(4-fluorophenyl)-6-(3-fluorophenyl)sulfonyl-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-2-yl)methanone |
|---|---|
| PubChem CID | 72548923 |
| Molecular Formula | C26H20F2N4O3S2 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.09 |
| IUPAC Name | [(4aR)-1-(4-fluorophenyl)-6-(3-fluorophenyl)sulfonyl-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-2-yl)methanone |
| SMILES | O=C(c1nccs1)[C@]12Cc3cnn(-c4ccc(F)cc4)c3C=C1CCN(S(=O)(=O)c1cccc(F)c1)C2 |
| InChI | InChI=1S/C26H20F2N4O3S2/c27-19-4-6-21(7-5-19)32-23-12-18-8-10-31(37(34,35)22-3-1-2-20(28)13-22)16-26(18,14-17(23)15-30-32)24(33)25-29-9-11-36-25/h1-7,9,11-13,15H,8,10,14,16H2/t26-/m0/s1 |
| InChIKey | QPTVGBQZEJXRHX-SANMLTNESA-N |
| XLogP | 4.51 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |