C25H25FN4O4S2 — CID 72548924
[(4aR)-1-(4-fluorophenyl)-6-(oxolan-2-ylmethylsulfonyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-2-yl)methanone (PubChem CID 72548924) has the molecular formula C25H25FN4O4S2 and a molecular weight of 528.63 g/mol. Its IUPAC name is [(4aR)-1-(4-fluorophenyl)-6-(oxolan-2-ylmethylsulfonyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-2-yl)methanone.
| Compound Name | [(4aR)-1-(4-fluorophenyl)-6-(oxolan-2-ylmethylsulfonyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-2-yl)methanone |
|---|---|
| PubChem CID | 72548924 |
| Molecular Formula | C25H25FN4O4S2 |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | [(4aR)-1-(4-fluorophenyl)-6-(oxolan-2-ylmethylsulfonyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-2-yl)methanone |
| SMILES | O=C(c1nccs1)[C@]12Cc3cnn(-c4ccc(F)cc4)c3C=C1CCN(S(=O)(=O)CC1CCCO1)C2 |
| InChI | InChI=1S/C25H25FN4O4S2/c26-19-3-5-20(6-4-19)30-22-12-18-7-9-29(36(32,33)15-21-2-1-10-34-21)16-25(18,13-17(22)14-28-30)23(31)24-27-8-11-35-24/h3-6,8,11-12,14,21H,1-2,7,9-10,13,15-16H2/t21?,25-/m0/s1 |
| InChIKey | DIKRBIQUFDZJNI-QBGQUKIHSA-N |
| XLogP | 3.49 |
| TPSA | 94.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |