C17H21Cl2N3O3S — CID 72549100
4-(2,4-dichlorophenoxy)-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidine (PubChem CID 72549100) has the molecular formula C17H21Cl2N3O3S and a molecular weight of 418.35 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidine.
| Compound Name | 4-(2,4-dichlorophenoxy)-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidine |
|---|---|
| PubChem CID | 72549100 |
| Molecular Formula | C17H21Cl2N3O3S |
| Molecular Weight | 418.35 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidine |
| SMILES | Cc1nn(C)c(C)c1S(=O)(=O)N1CCC(Oc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C17H21Cl2N3O3S/c1-11-17(12(2)21(3)20-11)26(23,24)22-8-6-14(7-9-22)25-16-5-4-13(18)10-15(16)19/h4-5,10,14H,6-9H2,1-3H3 |
| InChIKey | CMRIIDVXEGRYJU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |